Products 2173253-14-8
CAS 2173253-14-8 is the registry number for 4-(4-Bromophenyl)-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 2173253-14-8) is a chemical compound with the molecular formula C15H13BrN2O and a molecular weight of 317.18 g/mol. IUPAC name: 2-(4-bromophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: VRRIBAAJNGOXJJ-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2O |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | VRRIBAAJNGOXJJ-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2NC1=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)