CAS 17972-72-4 is the registry number for 7-Bromo-5-phenyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-bromo-5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one (CAS 17972-72-4) is a chemical compound with the molecular formula C15H13BrN2O and a molecular weight of 317.18 g/mol. IUPAC name: 7-bromo-5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one. InChIKey: OHKBVRBTRGJEMT-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2O |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 7-bromo-5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one |
| InChIKey | OHKBVRBTRGJEMT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)