CAS 1024599-62-9 is the registry number for 5-(1,1-Difluoroethyl)-1-methyl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,1-difluoroethyl)-1-methylpyrazole-3-carboxylic acid (CAS 1024599-62-9) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: 5-(1,1-difluoroethyl)-1-methylpyrazole-3-carboxylic acid. InChIKey: RLKASHOOVQJHAK-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 5-(1,1-difluoroethyl)-1-methylpyrazole-3-carboxylic acid |
| InChIKey | RLKASHOOVQJHAK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NN1C)C(=O)O)(F)F |
Computed by PubChem (NCBI)