Products 1855889-61-0

CAS 1855889-61-0 is the registry number for 2-(3-(Difluoromethyl)-4-methyl-1H-pyrazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[3-(difluoromethyl)-4-methylpyrazol-1-yl]acetic acid (CAS 1855889-61-0) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: 2-[3-(difluoromethyl)-4-methylpyrazol-1-yl]acetic acid. InChIKey: JBPKQXOSXIDHAL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2N2O2
Molecular weight190.15 g/mol
IUPAC name2-[3-(difluoromethyl)-4-methylpyrazol-1-yl]acetic acid
InChIKeyJBPKQXOSXIDHAL-UHFFFAOYSA-N
SMILESCC1=CN(N=C1C(F)F)CC(=O)O

Computed by PubChem (NCBI)