Products 957487-29-5

CAS 957487-29-5 is the registry number for [3-(Difluoromethyl)-5-methyl-1h-pyrazol-1-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetic acid (CAS 957487-29-5) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetic acid. InChIKey: ZHCDOVBRCTYUSV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2N2O2
Molecular weight190.15 g/mol
IUPAC name2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]acetic acid
InChIKeyZHCDOVBRCTYUSV-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC(=O)O)C(F)F

Computed by PubChem (NCBI)