Products 1784571-39-6
CAS 1784571-39-6 appears in our catalog under these names: 2-(3,3-Difluoropropyl)pyrazole-3-carboxylic acid, 95%, 2-(3,3-Difluoropropyl)pyrazole-3-carboxylic acid, 97%, 2-(3,3-Difluoropropyl)pyrazole-3-carboxylic acid, 97%, 97%, 2-(3,3-Difluoropropyl)pyrazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 500mg.
2-(3,3-difluoropropyl)pyrazole-3-carboxylic acid (CAS 1784571-39-6) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: 2-(3,3-difluoropropyl)pyrazole-3-carboxylic acid. InChIKey: XKJZXHMMAOCVDS-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2-(3,3-difluoropropyl)pyrazole-3-carboxylic acid |
| InChIKey | XKJZXHMMAOCVDS-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CCC(F)F)C(=O)O |
Computed by PubChem (NCBI)