Products 1024611-24-2

CAS 1024611-24-2 is the registry number for Ethyl 2,4-dioxo-4-(thiophen-3-yl)butanoate, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,4-dioxo-4-thiophen-3-ylbutanoate (CAS 1024611-24-2) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: ethyl 2,4-dioxo-4-thiophen-3-ylbutanoate. InChIKey: NOLPEOHACKQESP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O4S
Molecular weight226.25 g/mol
IUPAC nameethyl 2,4-dioxo-4-thiophen-3-ylbutanoate
InChIKeyNOLPEOHACKQESP-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CSC=C1

Computed by PubChem (NCBI)