CAS 41907-42-0 appears in our catalog under these names: 2-[(2-Carboxyethyl)thio]benzoic acid, 95%, 2-((2-Carboxyethyl)thio)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(2-carboxyethylsulfanyl)benzoic acid (CAS 41907-42-0) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: 2-(2-carboxyethylsulfanyl)benzoic acid. InChIKey: NDKGQQDWNLMZND-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-(2-carboxyethylsulfanyl)benzoic acid |
| InChIKey | NDKGQQDWNLMZND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCCC(=O)O |
Computed by PubChem (NCBI)