CAS 924829-00-5 is the registry number for Methyl 4-(5-methylthiophen-2-yl)-2,4-dioxobutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(5-methylthiophen-2-yl)-2,4-dioxobutanoate (CAS 924829-00-5) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: methyl 4-(5-methylthiophen-2-yl)-2,4-dioxobutanoate. InChIKey: BDMQWNJHVPOCQW-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | methyl 4-(5-methylthiophen-2-yl)-2,4-dioxobutanoate |
| InChIKey | BDMQWNJHVPOCQW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)