Products 893566-62-6
CAS 893566-62-6 is the registry number for Methyl 1,3-dihydrobenzo[c]thiophene-5-carboxylate 2,2-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylate (CAS 893566-62-6) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: methyl 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylate. InChIKey: MLRJFQMHRPPHBO-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | methyl 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-carboxylate |
| InChIKey | MLRJFQMHRPPHBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CS(=O)(=O)C2)C=C1 |
Computed by PubChem (NCBI)