CAS 1024672-20-5 is the registry number for 2-(2-aza-2-(dimethylamino)-1-(4-methoxyphenyl)vinyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[N-(dimethylamino)-C-(4-methoxyphenyl)carbonimidoyl]indene-1,3-dione (CAS 1024672-20-5) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 2-[N-(dimethylamino)-C-(4-methoxyphenyl)carbonimidoyl]indene-1,3-dione. InChIKey: QTIKWFKEVBJXNT-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-[N-(dimethylamino)-C-(4-methoxyphenyl)carbonimidoyl]indene-1,3-dione |
| InChIKey | QTIKWFKEVBJXNT-UHFFFAOYSA-N |
| SMILES | CN(C)N=C(C1C(=O)C2=CC=CC=C2C1=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)