Products 1024888-77-4
CAS 1024888-77-4 is the registry number for 3-methyl-1-phenyl-4-(((4-phenoxyphenyl)amino)methylene)-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
5-methyl-4-[(4-phenoxyphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one (CAS 1024888-77-4) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 5-methyl-4-[(4-phenoxyphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one. InChIKey: RHZMVKJBGHAOON-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-methyl-4-[(4-phenoxyphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one |
| InChIKey | RHZMVKJBGHAOON-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=CC=CC=C2)C=NC3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)