Products 1025058-85-8
CAS 1025058-85-8 is the registry number for 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylic acid (CAS 1025058-85-8) is a chemical compound with the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylic acid. InChIKey: BGUYMWFCTCFMEF-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-3-carboxylic acid |
| InChIKey | BGUYMWFCTCFMEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCCC(C2)C(=O)O |
Computed by PubChem (NCBI)