CAS 956352-22-0 is the registry number for 1-(1,3-Dimethyl-1H-pyrazole-4-sulfonyl)-piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid (CAS 956352-22-0) is a chemical compound with the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. IUPAC name: 1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid. InChIKey: DQMYSNIYBRSFDO-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | 1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | DQMYSNIYBRSFDO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1S(=O)(=O)N2CCCC(C2)C(=O)O)C |
Computed by PubChem (NCBI)