CAS 725692-60-4 appears in our catalog under these names: N-(2-Hydrazino-2-oxoethyl)-n-(4-methoxyphenyl)ethanesulfonamide, 95%, N-(2-Hydrazinyl-2-oxoethyl)-N-(4-methoxyphenyl)ethanesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(2-hydrazinyl-2-oxoethyl)-N-(4-methoxyphenyl)ethanesulfonamide (CAS 725692-60-4) is a chemical compound with the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. IUPAC name: N-(2-hydrazinyl-2-oxoethyl)-N-(4-methoxyphenyl)ethanesulfonamide. InChIKey: LTQIUNDOHZAJPV-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | N-(2-hydrazinyl-2-oxoethyl)-N-(4-methoxyphenyl)ethanesulfonamide |
| InChIKey | LTQIUNDOHZAJPV-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(CC(=O)NN)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)