CAS 1171069-02-5 appears in our catalog under these names: 1-(1,2-Dimethyl-1h-imidazole-4-sulfonyl)piperidine-4-carboxylic acid, 95%, 1-((1,2-Dimethyl-1H-imidazol-4-yl)sulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylic acid (CAS 1171069-02-5) is a chemical compound with the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. IUPAC name: 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylic acid. InChIKey: GLQFVIHELXKZGG-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | GLQFVIHELXKZGG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1C)S(=O)(=O)N2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)