CAS 102507-17-5 is the registry number for rel-(2R,3S)-2-((tert-Butoxycarbonyl)amino)-3-hydroxy-4-methylpentanoic acid, 97+%. Offered by: AmBeed. Available pack sizes: 1g.
(2S,3R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 102507-17-5) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2S,3R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: ISRKGGQOVLQWDW-JGVFFNPUSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | ISRKGGQOVLQWDW-JGVFFNPUSA-N |
| SMILES | CC(C)[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)