CAS 10252-00-3 is the registry number for Methyl n-(4-aminophenyl)-n-methylcarbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl N-(4-aminophenyl)-N-methylcarbamate (CAS 10252-00-3) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: methyl N-(4-aminophenyl)-N-methylcarbamate. InChIKey: ZKGGELKXEUSJSA-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl N-(4-aminophenyl)-N-methylcarbamate |
| InChIKey | ZKGGELKXEUSJSA-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)