Products 1025281-03-1
CAS 1025281-03-1 is the registry number for 4-((4-acetylphenyl)amino)-3-(phenylsulfonyl)but-3-en-2-one. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-4-(4-acetylanilino)-3-(benzenesulfonyl)but-3-en-2-one (CAS 1025281-03-1) is a chemical compound with the molecular formula C18H17NO4S and a molecular weight of 343.4 g/mol. IUPAC name: (Z)-4-(4-acetylanilino)-3-(benzenesulfonyl)but-3-en-2-one. InChIKey: BGEJGDCSVREPPW-PDGQHHTCSA-N.
| Molecular formula | C18H17NO4S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (Z)-4-(4-acetylanilino)-3-(benzenesulfonyl)but-3-en-2-one |
| InChIKey | BGEJGDCSVREPPW-PDGQHHTCSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N/C=C(/C(=O)C)\S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)