CAS 299965-49-4 is the registry number for N-Butyl-9,10-dioxo-9,10-dihydroanthracene-2-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-butyl-9,10-dioxoanthracene-2-sulfonamide (CAS 299965-49-4) is a chemical compound with the molecular formula C18H17NO4S and a molecular weight of 343.4 g/mol. IUPAC name: N-butyl-9,10-dioxoanthracene-2-sulfonamide. InChIKey: QBLAFIGMHLSEOR-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | N-butyl-9,10-dioxoanthracene-2-sulfonamide |
| InChIKey | QBLAFIGMHLSEOR-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)