CAS 157355-80-1 appears in our catalog under these names: Fmoc-d-cys-oh h2o, 95%, Fmoc-d-cys-oh, 95%, N-Fmoc-D-cysteine, Fmoc-D-Cys-OH*H2O, Fmoc-D-Cys-OH.H2O 95% (hydrate). Offered by: Combi-blocks, TRC, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 500mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid (CAS 157355-80-1) is a chemical compound with the molecular formula C18H17NO4S and a molecular weight of 343.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid. InChIKey: RMTDKXQYAKLQKF-MRXNPFEDSA-N.
| Molecular formula | C18H17NO4S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid |
| InChIKey | RMTDKXQYAKLQKF-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CS)C(=O)O |
Computed by PubChem (NCBI)