CAS 135248-89-4 appears in our catalog under these names: N-Fmoc-L-cysteine, >95% (HPLC), (((9H–Fluoren–9–yl)methoxy)carbonyl)–L–cysteine, Fmoc-L-Cys-OH*H2O, Fmoc-L-cysteine, Fmoc-L-Cysteine 98%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 500mg, 5g, 10g, 25g, 1000mg, 2000mg, 5000mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid (CAS 135248-89-4) is a chemical compound with the molecular formula C18H17NO4S and a molecular weight of 343.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid. InChIKey: RMTDKXQYAKLQKF-INIZCTEOSA-N.
| Molecular formula | C18H17NO4S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoic acid |
| InChIKey | RMTDKXQYAKLQKF-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)