CAS 1025451-28-8 is the registry number for tert-Butyl ((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate (CAS 1025451-28-8) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: tert-butyl N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate. InChIKey: DKOFIBMWVQNGKI-IUCAKERBSA-N.
| Molecular formula | C12H20N2O4 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate |
| InChIKey | DKOFIBMWVQNGKI-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H]1CCNC1=O)C=O |
Computed by PubChem (NCBI)