Products 14205-47-1
CAS 14205-47-1 appears in our catalog under these names: 1,4-Butanediol bis(3-aminocrotonate), 95%, 1,4–Butanediol Bis(3–aminocrotonate), 3-Amino-2-butenoic acid (1,4-butanediyl) ester, 1,4-Butanediol Bis(3-aminocrotonate), >96.0%(GC), 2-Butenoic acid, 3-amino-, 1,1'-(1,4-butanediyl) ester, 96%+, 96%+. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g, 250g, 1000g, 2000g.
4-(3-aminobut-2-enoyloxy)butyl 3-aminobut-2-enoate (CAS 14205-47-1) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: 4-(3-aminobut-2-enoyloxy)butyl 3-aminobut-2-enoate. InChIKey: DFUXQARZEWMFLQ-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O4 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 4-(3-aminobut-2-enoyloxy)butyl 3-aminobut-2-enoate |
| InChIKey | DFUXQARZEWMFLQ-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)OCCCCOC(=O)C=C(C)N)N |
Computed by PubChem (NCBI)
Synonyms:
Butanediyl bis(3-aminobut-2-enoate), 2-Butenoic acid, 3-amino-, 1,4-butanediyl ester, 2-Butenoic acid, 3-amino-, 1,1'-(1,4-butanediyl) ester, butane-1,4-diyl bis(3-aminobut-2-enoate), Crotonic acid, 3-amino-, tetramethylene ester, 3-Amino-2-butenoic acid (1,4-butanediyl) ester, 4-(3-aminobut-2-enoyloxy)butyl 3-aminobut-2-enoate, DFUXQARZEWMFLQ-UHFFFAOYSA-N