Products 1638767-88-0
CAS 1638767-88-0 appears in our catalog under these names: 5-Azaspiro[2.3]hexane hemioxalate, 95%, 5-Azaspiro(2.3)hexane hemioxalate, 97%, 5–Azaspiro(2·3)hexane hemioxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
Bis(5-azaspiro[2.3]hexane);oxalic acid (CAS 1638767-88-0) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: bis(5-azaspiro[2.3]hexane);oxalic acid. InChIKey: XLVQQCLHAATQTR-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O4 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | bis(5-azaspiro[2.3]hexane);oxalic acid |
| InChIKey | XLVQQCLHAATQTR-UHFFFAOYSA-N |
| SMILES | C1CC12CNC2.C1CC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)