Products 266353-18-8

CAS 266353-18-8 is the registry number for Ethyl 2-{[(tert-butoxy)carbonyl](2-cyanoethyl)amino}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-cyanoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate (CAS 266353-18-8) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: ethyl 2-[2-cyanoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate. InChIKey: ZCWTZPDRNDETAD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O4
Molecular weight256.30 g/mol
IUPAC nameethyl 2-[2-cyanoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate
InChIKeyZCWTZPDRNDETAD-UHFFFAOYSA-N
SMILESCCOC(=O)CN(CCC#N)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)