CAS 1025456-44-3 appears in our catalog under these names: [2,2'-Binaphthalen]-6-ylboronic acid, 95%, (2,2'-Binaphthalen)-6-ylboronic acid, 98%, (2，2'–Binaphthalen)–6–ylboronic Acid, [2,2'-Binaphthalen]-6-ylboronic Acid (contains varying amounts of Anhydride), [2,2'-Binaphthalen]-6-ylboronic acid 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 5g, 200mg.
(6-naphthalen-2-ylnaphthalen-2-yl)boronic acid (CAS 1025456-44-3) is a chemical compound with the molecular formula C20H15BO2 and a molecular weight of 298.1 g/mol. IUPAC name: (6-naphthalen-2-ylnaphthalen-2-yl)boronic acid. InChIKey: RVXRXLWMFONJPE-UHFFFAOYSA-N.
| Molecular formula | C20H15BO2 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | (6-naphthalen-2-ylnaphthalen-2-yl)boronic acid |
| InChIKey | RVXRXLWMFONJPE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)C3=CC4=CC=CC=C4C=C3)(O)O |
Computed by PubChem (NCBI)