Products 363607-69-6
CAS 363607-69-6 appears in our catalog under these names: 4-(Naphthalene-1-yl)-1-naphthalene boronic acid, 98%, B-(1,1'-Binaphthalen)-4-ylboronic acid, 95-<97%, B-(1,1'-Binaphthalen)-4-ylboronic acid, ≥97-<99%, [1,1'-Binaphthalen]-4-ylboronic Acid (contains varying amounts of Anhydride), [1,1'-Binaphthalen]-4-ylboronic acid 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 50g, 100g, 200g, 300g, 400g, 500g.
(4-naphthalen-1-ylnaphthalen-1-yl)boronic acid (CAS 363607-69-6) is a chemical compound with the molecular formula C20H15BO2 and a molecular weight of 298.1 g/mol. IUPAC name: (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid. InChIKey: GKRWMBPEFXXULT-UHFFFAOYSA-N.
| Molecular formula | C20H15BO2 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid |
| InChIKey | GKRWMBPEFXXULT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)C3=CC=CC4=CC=CC=C43)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Binaphthalen]-4-ylboronic Acid (contains varying amounts of Anhydride), (1,1'-Binaphthalen)-4-ylboronic Acid (contains varying amounts of Anhydride), [1,1'-Binaphthalen]-4-ylboronic acid, (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid, 4-(1-Naphthyl)naphthalene-1-boronic acid, [1,1'-Binaphthalen]-4-ylboronicacid, 4-(naphthalene-1-yl)-1-naphthalene boronic acid, 1,1'-binaphthyl-4-ylboronic acid, [11'-Binaphthalen]-4-ylboronic acid, 4-(1-Naphthyl)-1-Naphthylboronic acid