CAS 1251773-23-5 is the registry number for (2–(phenanthren–9–yl)phenyl)boronicacid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
(2-phenanthren-9-ylphenyl)boronic acid (CAS 1251773-23-5) is a chemical compound with the molecular formula C20H15BO2 and a molecular weight of 298.1 g/mol. IUPAC name: (2-phenanthren-9-ylphenyl)boronic acid. InChIKey: LCMHFRQDKFRQOZ-UHFFFAOYSA-N.
| Molecular formula | C20H15BO2 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | (2-phenanthren-9-ylphenyl)boronic acid |
| InChIKey | LCMHFRQDKFRQOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC3=CC=CC=C3C4=CC=CC=C42)(O)O |
Computed by PubChem (NCBI)