CAS 737764-74-8 appears in our catalog under these names: (4-(Phenanthren-9-yl)phenyl)boronic acid 95%, (4-(Phenanthren-9-yl)phenyl)boronic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
(4-phenanthren-9-ylphenyl)boronic acid (CAS 737764-74-8) is a chemical compound with the molecular formula C20H15BO2 and a molecular weight of 298.1 g/mol. IUPAC name: (4-phenanthren-9-ylphenyl)boronic acid. InChIKey: BRMXCUCHGKWTIO-UHFFFAOYSA-N.
| Molecular formula | C20H15BO2 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | (4-phenanthren-9-ylphenyl)boronic acid |
| InChIKey | BRMXCUCHGKWTIO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC3=CC=CC=C3C4=CC=CC=C42)(O)O |
Computed by PubChem (NCBI)