Products 1025564-19-5
CAS 1025564-19-5 is the registry number for 5,6-dimethoxy-2-(3-phenylprop-2-enylidene)indan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
(2E)-5,6-dimethoxy-2-[(E)-3-phenylprop-2-enylidene]-3H-inden-1-one (CAS 1025564-19-5) is a chemical compound with the molecular formula C20H18O3 and a molecular weight of 306.4 g/mol. IUPAC name: (2E)-5,6-dimethoxy-2-[(E)-3-phenylprop-2-enylidene]-3H-inden-1-one. InChIKey: IPLAHEVBLYESPH-UJHPFZFGSA-N.
| Molecular formula | C20H18O3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | (2E)-5,6-dimethoxy-2-[(E)-3-phenylprop-2-enylidene]-3H-inden-1-one |
| InChIKey | IPLAHEVBLYESPH-UJHPFZFGSA-N |
| SMILES | COC1=C(C=C2C(=C1)C/C(=C\C=C\C3=CC=CC=C3)/C2=O)OC |
Computed by PubChem (NCBI)