Products 1171921-63-3

CAS 1171921-63-3 is the registry number for Methyl 2-hydroxy-6-(2-(naphthalen-2-yl)ethyl)benzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoate (CAS 1171921-63-3) is a chemical compound with the molecular formula C20H18O3 and a molecular weight of 306.4 g/mol. IUPAC name: methyl 2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoate. InChIKey: RLIXFDIMXMACNI-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O3
Molecular weight306.4 g/mol
IUPAC namemethyl 2-hydroxy-6-(2-naphthalen-2-ylethyl)benzoate
InChIKeyRLIXFDIMXMACNI-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC=C1O)CCC2=CC3=CC=CC=C3C=C2

Computed by PubChem (NCBI)