Products 35556-97-9
CAS 35556-97-9 is the registry number for 2-(2-oxo-2-phenylethyl)-5-phenylcyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-phenacyl-5-phenylcyclohexane-1,3-dione (CAS 35556-97-9) is a chemical compound with the molecular formula C20H18O3 and a molecular weight of 306.4 g/mol. IUPAC name: 2-phenacyl-5-phenylcyclohexane-1,3-dione. InChIKey: WEOFFZREWDGICH-UHFFFAOYSA-N.
| Molecular formula | C20H18O3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2-phenacyl-5-phenylcyclohexane-1,3-dione |
| InChIKey | WEOFFZREWDGICH-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C(C1=O)CC(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)