CAS 25671-98-1 is the registry number for 2,6-Bis(3-(furan-2-yl)prop-2-en-1-ylidene)cyclohexan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2E,6E)-2,6-bis[(E)-3-(furan-2-yl)prop-2-enylidene]cyclohexan-1-one (CAS 25671-98-1) is a chemical compound with the molecular formula C20H18O3 and a molecular weight of 306.4 g/mol. IUPAC name: (2E,6E)-2,6-bis[(E)-3-(furan-2-yl)prop-2-enylidene]cyclohexan-1-one. InChIKey: SHPLADCLSRWYLI-ZOFYMTOZSA-N.
| Molecular formula | C20H18O3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | (2E,6E)-2,6-bis[(E)-3-(furan-2-yl)prop-2-enylidene]cyclohexan-1-one |
| InChIKey | SHPLADCLSRWYLI-ZOFYMTOZSA-N |
| SMILES | C1C/C(=C\C=C\C2=CC=CO2)/C(=O)/C(=C/C=C/C3=CC=CO3)/C1 |
Computed by PubChem (NCBI)