Products 1025630-40-3
CAS 1025630-40-3 is the registry number for 2-acetyl-3-((3,4-dimethoxyphenyl)amino)-N-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide (CAS 1025630-40-3) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: (E)-2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide. InChIKey: JAFHKDMRTQYBRL-HMMHOXNUSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (E)-2-[(3,4-dimethoxyphenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide |
| InChIKey | JAFHKDMRTQYBRL-HMMHOXNUSA-N |
| SMILES | C/C(=C(/C=NC1=CC(=C(C=C1)OC)OC)\C(=O)NC2=CC=CC=C2)/O |
Computed by PubChem (NCBI)