Products 1025640-65-6
CAS 1025640-65-6 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(pyrimidin-2-ylamino)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(2Z)-4,4-dimethyl-3-oxo-2-[(pyrimidin-2-ylamino)methylidene]pentanenitrile (CAS 1025640-65-6) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: (2Z)-4,4-dimethyl-3-oxo-2-[(pyrimidin-2-ylamino)methylidene]pentanenitrile. InChIKey: GGINKVJHGLEZTE-HJWRWDBZSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | (2Z)-4,4-dimethyl-3-oxo-2-[(pyrimidin-2-ylamino)methylidene]pentanenitrile |
| InChIKey | GGINKVJHGLEZTE-HJWRWDBZSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C\NC1=NC=CC=N1)/C#N |
Computed by PubChem (NCBI)