Products 1025900-35-9
CAS 1025900-35-9 appears in our catalog under these names: (4-((Diisopropylamino)methyl)phenyl)boronic acid, 95%, (4–((Diisopropylamino)methyl)phenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[4-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid (CAS 1025900-35-9) is a chemical compound with the molecular formula C13H22BNO2 and a molecular weight of 235.13 g/mol. IUPAC name: [4-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid. InChIKey: MWEBNHUKQKORGU-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO2 |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | [4-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid |
| InChIKey | MWEBNHUKQKORGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN(C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)