CAS 2772654-91-6 is the registry number for 5-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile (CAS 2772654-91-6) is a chemical compound with the molecular formula C13H22BNO2 and a molecular weight of 235.13 g/mol. IUPAC name: (E)-5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile. InChIKey: DBZWKQTVTUYTQH-ZHACJKMWSA-N.
| Molecular formula | C13H22BNO2 |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | (E)-5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
| InChIKey | DBZWKQTVTUYTQH-ZHACJKMWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/CCCC#N |
Computed by PubChem (NCBI)