CAS 1256359-32-6 appears in our catalog under these names: 1,2,5-Trimethylpyrrole-3-boronic acid, pinacol ester, 96%, 1,2,5-Trimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1,2,5-trimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1256359-32-6) is a chemical compound with the molecular formula C13H22BNO2 and a molecular weight of 235.13 g/mol. IUPAC name: 1,2,5-trimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: KDIWNNXNKFMYHU-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO2 |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | 1,2,5-trimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | KDIWNNXNKFMYHU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(C(=C2)C)C)C |
Computed by PubChem (NCBI)