Products 2225177-77-3
CAS 2225177-77-3 is the registry number for 2，6–BIS(TERT–BUTYL)PYRIDINE–4–BORONIC ACID. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2,6-ditert-butyl-4-pyridinyl)boronic acid (CAS 2225177-77-3) is a chemical compound with the molecular formula C13H22BNO2 and a molecular weight of 235.13 g/mol. IUPAC name: (2,6-ditert-butyl-4-pyridinyl)boronic acid. InChIKey: GERJIPNOEIIQCC-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO2 |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | (2,6-ditert-butyl-4-pyridinyl)boronic acid |
| InChIKey | GERJIPNOEIIQCC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C(C)(C)C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)