Products 102599-59-7
CAS 102599-59-7 is the registry number for 2-(3,4-Bis(benzyloxy)phenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyacetic acid (CAS 102599-59-7) is a chemical compound with the molecular formula C22H20O5 and a molecular weight of 364.4 g/mol. IUPAC name: 2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyacetic acid. InChIKey: IZEJOHXHFHRXHW-UHFFFAOYSA-N.
| Molecular formula | C22H20O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyacetic acid |
| InChIKey | IZEJOHXHFHRXHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(C(=O)O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)