Products 70845-73-7

CAS 70845-73-7 is the registry number for 3,4-Bis(benzyloxy)-5-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-methoxy-4,5-bis(phenylmethoxy)benzoic acid (CAS 70845-73-7) is a chemical compound with the molecular formula C22H20O5 and a molecular weight of 364.4 g/mol. IUPAC name: 3-methoxy-4,5-bis(phenylmethoxy)benzoic acid. InChIKey: NAMUJFYSOGQDCY-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20O5
Molecular weight364.4 g/mol
IUPAC name3-methoxy-4,5-bis(phenylmethoxy)benzoic acid
InChIKeyNAMUJFYSOGQDCY-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C(=O)O)OCC2=CC=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)