Products 59229-14-0
CAS 59229-14-0 is the registry number for 3,5-Dibenzyloxyphenylglyoxal hydrate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-[3,5-bis(phenylmethoxy)phenyl]-2-oxoacetaldehyde;hydrate (CAS 59229-14-0) is a chemical compound with the molecular formula C22H20O5 and a molecular weight of 364.4 g/mol. IUPAC name: 2-[3,5-bis(phenylmethoxy)phenyl]-2-oxoacetaldehyde;hydrate. InChIKey: KBDOJJCCLUXJLQ-UHFFFAOYSA-N.
| Molecular formula | C22H20O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[3,5-bis(phenylmethoxy)phenyl]-2-oxoacetaldehyde;hydrate |
| InChIKey | KBDOJJCCLUXJLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)C=O)OCC3=CC=CC=C3.O |
Computed by PubChem (NCBI)