Products 1606149-62-5
CAS 1606149-62-5 appears in our catalog under these names: Platachromone A, Platachromone A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5,7-dihydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-(3-methylbut-2-enyl)chromen-4-one (CAS 1606149-62-5) is a chemical compound with the molecular formula C22H20O5 and a molecular weight of 364.4 g/mol. IUPAC name: 5,7-dihydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-(3-methylbut-2-enyl)chromen-4-one. InChIKey: JCAGQYRMQLGPBF-RMKNXTFCSA-N.
| Molecular formula | C22H20O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | JCAGQYRMQLGPBF-RMKNXTFCSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC(=CC2=O)/C=C/C3=CC=C(C=C3)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Platachromone A, orb1680975