CAS 102630-90-0 is the registry number for 3-Amino-n-(3,5-dimethylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-amino-N-(3,5-dimethylphenyl)benzamide (CAS 102630-90-0) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 3-amino-N-(3,5-dimethylphenyl)benzamide. InChIKey: YFZPKHBDGWIZMN-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3-amino-N-(3,5-dimethylphenyl)benzamide |
| InChIKey | YFZPKHBDGWIZMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)C2=CC(=CC=C2)N)C |
Computed by PubChem (NCBI)