Products 1026417-03-7
CAS 1026417-03-7 is the registry number for Ethyl 3-methyl-7-oxo-6,7-dihydro-5h-cyclopenta[c]pyridine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 3-methyl-7-oxo-5,6-dihydrocyclopenta[c]pyridine-6-carboxylate (CAS 1026417-03-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: ethyl 3-methyl-7-oxo-5,6-dihydrocyclopenta[c]pyridine-6-carboxylate. InChIKey: ZFKCLYRGGDRTAW-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | ethyl 3-methyl-7-oxo-5,6-dihydrocyclopenta[c]pyridine-6-carboxylate |
| InChIKey | ZFKCLYRGGDRTAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C1=O)C=NC(=C2)C |
Computed by PubChem (NCBI)