CAS 102653-57-6 is the registry number for 3-(3,4-Dichlorobenzyl)thiazolidine-2,4-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (CAS 102653-57-6) is a chemical compound with the molecular formula C10H7Cl2NO2S and a molecular weight of 276.14 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: HBRHVYDRMDAFSM-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2S |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | HBRHVYDRMDAFSM-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)