CAS 102653-72-5 is the registry number for 3-[(2,4-Dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (CAS 102653-72-5) is a chemical compound with the molecular formula C10H7Cl2NO2S and a molecular weight of 276.14 g/mol. IUPAC name: 3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: KMTGHSQTIQMIMA-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2S |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | KMTGHSQTIQMIMA-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)