CAS 1422502-60-0 appears in our catalog under these names: 2, 4–Dichloro–6–methylsulfonylquinoline, 2,4-dichloro-6-(methylsulfonyl)quinoline, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
2,4-dichloro-6-methylsulfonylquinoline (CAS 1422502-60-0) is a chemical compound with the molecular formula C10H7Cl2NO2S and a molecular weight of 276.14 g/mol. IUPAC name: 2,4-dichloro-6-methylsulfonylquinoline. InChIKey: ZYKFCVNHQYUCIJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2S |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2,4-dichloro-6-methylsulfonylquinoline |
| InChIKey | ZYKFCVNHQYUCIJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)