CAS 99429-69-3 is the registry number for Ethyl 4,6-dichlorothieno[2,3-b]pyridine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4,6-dichlorothieno[2,3-b]pyridine-5-carboxylate (CAS 99429-69-3) is a chemical compound with the molecular formula C10H7Cl2NO2S and a molecular weight of 276.14 g/mol. IUPAC name: ethyl 4,6-dichlorothieno[2,3-b]pyridine-5-carboxylate. InChIKey: FGQYQSAIXVWVKX-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2S |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | ethyl 4,6-dichlorothieno[2,3-b]pyridine-5-carboxylate |
| InChIKey | FGQYQSAIXVWVKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C(=C1Cl)C=CS2)Cl |
Computed by PubChem (NCBI)